C37H29F3N2O3 — CID 46102970
1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-diphenylethanone (PubChem CID 46102970) has the molecular formula C37H29F3N2O3 and a molecular weight of 606.64 g/mol. Its IUPAC name is 1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-diphenylethanone.
| Compound Name | 1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 46102970 |
| Molecular Formula | C37H29F3N2O3 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-diphenylethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)C(c1ccccc1)c1ccccc1)C3c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C37H29F3N2O3/c1-44-25-16-17-30-28(22-25)26-20-21-42(36(43)33(23-10-4-2-5-11-23)24-12-6-3-7-13-24)35(34(26)41-30)32-19-18-31(45-32)27-14-8-9-15-29(27)37(38,39)40/h2-19,22,33,35,41H,20-21H2,1H3 |
| InChIKey | AKCAUVAAHNZWTN-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|