C27H23F3N2O5 — CID 46102979
methyl 3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropanoate (PubChem CID 46102979) has the molecular formula C27H23F3N2O5 and a molecular weight of 512.48 g/mol. Its IUPAC name is methyl 3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 46102979 |
| Molecular Formula | C27H23F3N2O5 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | methyl 3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N1CCc2c([nH]c3ccc(OC)cc23)C1c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C27H23F3N2O5/c1-35-15-7-8-20-18(13-15)16-11-12-32(23(33)14-24(34)36-2)26(25(16)31-20)22-10-9-21(37-22)17-5-3-4-6-19(17)27(28,29)30/h3-10,13,26,31H,11-12,14H2,1-2H3 |
| InChIKey | LTGCVURKESMZOC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|