C27H24ClF3N2O3 — CID 46102982
2-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one (PubChem CID 46102982) has the molecular formula C27H24ClF3N2O3 and a molecular weight of 516.95 g/mol. Its IUPAC name is 2-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one.
| Compound Name | 2-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 46102982 |
| Molecular Formula | C27H24ClF3N2O3 |
| Molecular Weight | 516.95 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
| SMILES | CCC(Cl)C(=O)N1CCc2c([nH]c3ccc(OC)cc23)C1c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C27H24ClF3N2O3/c1-3-20(28)26(34)33-13-12-16-18-14-15(35-2)8-9-21(18)32-24(16)25(33)23-11-10-22(36-23)17-6-4-5-7-19(17)27(29,30)31/h4-11,14,20,25,32H,3,12-13H2,1-2H3 |
| InChIKey | XJKWMXUTCOLPKY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.95 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|