C29H28ClF3N2O3 — CID 46102983
6-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one (PubChem CID 46102983) has the molecular formula C29H28ClF3N2O3 and a molecular weight of 545.00 g/mol. Its IUPAC name is 6-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one.
| Compound Name | 6-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 46102983 |
| Molecular Formula | C29H28ClF3N2O3 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 6-chloro-1-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)CCCCCCl)C3c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C29H28ClF3N2O3/c1-37-18-10-11-23-21(17-18)19-14-16-35(26(36)9-3-2-6-15-30)28(27(19)34-23)25-13-12-24(38-25)20-7-4-5-8-22(20)29(31,32)33/h4-5,7-8,10-13,17,28,34H,2-3,6,9,14-16H2,1H3 |
| InChIKey | OJIUWGIVPVQZNW-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|