C35H47FN2O4 — CID 46103603
5-[(3-fluorophenyl)methoxy]-2-[[4-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]piperazin-1-yl]methyl]pyran-4-one (PubChem CID 46103603) has the molecular formula C35H47FN2O4 and a molecular weight of 578.77 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methoxy]-2-[[4-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]piperazin-1-yl]methyl]pyran-4-one.
| Compound Name | 5-[(3-fluorophenyl)methoxy]-2-[[4-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]piperazin-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 46103603 |
| Molecular Formula | C35H47FN2O4 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 5-[(3-fluorophenyl)methoxy]-2-[[4-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]piperazin-1-yl]methyl]pyran-4-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)N1CCN(Cc2cc(=O)c(OCc3cccc(F)c3)co2)CC1 |
| InChI | InChI=1S/C35H47FN2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-35(40)38-23-21-37(22-24-38)27-32-26-33(39)34(29-41-32)42-28-30-18-17-19-31(36)25-30/h6-7,9-10,12-13,17-19,25-26,29H,2-5,8,11,14-16,20-24,27-28H2,1H3/b7-6-,10-9-,13-12- |
| InChIKey | XECTXXBGVRRDJX-QNEBEIHSSA-N |
| XLogP | 7.59 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|