C24H26O3 — CID 4610400
7-ethenyl-8-(2-hydroxy-3-prop-2-enylphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 4610400) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 7-ethenyl-8-(2-hydroxy-3-prop-2-enylphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | 7-ethenyl-8-(2-hydroxy-3-prop-2-enylphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 4610400 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 7-ethenyl-8-(2-hydroxy-3-prop-2-enylphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CCc1cccc(C2C(C=C)=CCC3C(=O)C(C)=C(C)C(=O)C32C)c1O |
| InChI | InChI=1S/C24H26O3/c1-6-9-17-10-8-11-18(22(17)26)20-16(7-2)12-13-19-21(25)14(3)15(4)23(27)24(19,20)5/h6-8,10-12,19-20,26H,1-2,9,13H2,3-5H3 |
| InChIKey | RMXPYEGDZQUVEZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|