C16H14N2O5S2 — CID 4610628
methyl 3-[(1-methyl-2,2,4-trioxo-2λ6,1-benzothiazin-3-ylidene)methylamino]thiophene-2-carboxylate (PubChem CID 4610628) has the molecular formula C16H14N2O5S2 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 3-[(1-methyl-2,2,4-trioxo-2λ6,1-benzothiazin-3-ylidene)methylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-methyl-2,2,4-trioxo-2λ6,1-benzothiazin-3-ylidene)methylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4610628 |
| Molecular Formula | C16H14N2O5S2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | methyl 3-[(1-methyl-2,2,4-trioxo-2λ6,1-benzothiazin-3-ylidene)methylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC=C1C(=O)c2ccccc2N(C)S1(=O)=O |
| InChI | InChI=1S/C16H14N2O5S2/c1-18-12-6-4-3-5-10(12)14(19)13(25(18,21)22)9-17-11-7-8-24-15(11)16(20)23-2/h3-9,17H,1-2H3 |
| InChIKey | UVCYRXABBZIJBG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|