C26H37N5O3 — CID 46106564
ethyl 4-[1-(1-cyclohexylbenzimidazol-2-yl)piperidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 46106564) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is ethyl 4-[1-(1-cyclohexylbenzimidazol-2-yl)piperidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(1-cyclohexylbenzimidazol-2-yl)piperidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46106564 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | ethyl 4-[1-(1-cyclohexylbenzimidazol-2-yl)piperidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCN(c3nc4ccccc4n3C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C26H37N5O3/c1-2-34-26(33)30-18-16-28(17-19-30)24(32)20-12-14-29(15-13-20)25-27-22-10-6-7-11-23(22)31(25)21-8-4-3-5-9-21/h6-7,10-11,20-21H,2-5,8-9,12-19H2,1H3 |
| InChIKey | VMGKZQWUMSFATB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |