About 2,4,6-triethylpyrylium
2,4,6-triethylpyrylium (PubChem CID 4610662) has the molecular formula C11H17O+
and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,4,6-triethylpyrylium.
Molecular Properties
| Compound Name | 2,4,6-triethylpyrylium |
| PubChem CID | 4610662 |
| Molecular Formula | C11H17O+ |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2,4,6-triethylpyrylium |
| SMILES | CCc1cc(CC)[o+]c(CC)c1 |
| InChI | InChI=1S/C11H17O/c1-4-9-7-10(5-2)12-11(6-3)8-9/h7-8H,4-6H2,1-3H3/q+1 |
| InChIKey | AZBIKLOVYDGMEP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-triethylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-triethylpyrylium?
The IUPAC name of 2,4,6-triethylpyrylium (CID 4610662) is 2,4,6-triethylpyrylium.
What is the SMILES notation for 2,4,6-triethylpyrylium?
The canonical SMILES for 2,4,6-triethylpyrylium is CCc1cc(CC)[o+]c(CC)c1.
What is the InChIKey of 2,4,6-triethylpyrylium?
The InChIKey is AZBIKLOVYDGMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O/c1-4-9-7-10(5-2)12-11(6-3)8-9/h7-8H,4-6H2,1-3H3/q+1.
What are the key properties of 2,4,6-triethylpyrylium?
2,4,6-triethylpyrylium has a molecular weight of 165.26 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-triethylpyrylium is sourced from PubChem (CID 4610662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).