About N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide
N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide (PubChem CID 46106892) has the molecular formula C19H14F2N4O
and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide |
| PubChem CID | 46106892 |
| Molecular Formula | C19H14F2N4O |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide |
| SMILES | CCc1cc(NC(=O)c2ccc(F)cc2F)nn1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H14F2N4O/c1-2-14-10-18(23-19(26)16-8-5-13(20)9-17(16)21)24-25(14)15-6-3-12(11-22)4-7-15/h3-10H,2H2,1H3,(H,23,24,26) |
| InChIKey | PIFGVYWSJKQXKK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide?
The IUPAC name of N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide (CID 46106892) is N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide.
What is the SMILES notation for N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide?
The canonical SMILES for N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide is CCc1cc(NC(=O)c2ccc(F)cc2F)nn1-c1ccc(C#N)cc1.
What is the InChIKey of N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide?
The InChIKey is PIFGVYWSJKQXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N4O/c1-2-14-10-18(23-19(26)16-8-5-13(20)9-17(16)21)24-25(14)15-6-3-12(11-22)4-7-15/h3-10H,2H2,1H3,(H,23,24,26).
What are the key properties of N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide?
N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide has a molecular weight of 352.34 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-cyanophenyl)-5-ethylpyrazol-3-yl]-2,4-difluorobenzamide is sourced from PubChem (CID 46106892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).