C31H45N3O5S — CID 46108875
N-[1-(4-butoxybenzoyl)piperidin-4-yl]-2-[ethylsulfonyl(propyl)amino]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 46108875) has the molecular formula C31H45N3O5S and a molecular weight of 571.78 g/mol. Its IUPAC name is N-[1-(4-butoxybenzoyl)piperidin-4-yl]-2-[ethylsulfonyl(propyl)amino]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | N-[1-(4-butoxybenzoyl)piperidin-4-yl]-2-[ethylsulfonyl(propyl)amino]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46108875 |
| Molecular Formula | C31H45N3O5S |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | N-[1-(4-butoxybenzoyl)piperidin-4-yl]-2-[ethylsulfonyl(propyl)amino]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | CCCCOc1ccc(C(=O)N2CCC(N(Cc3ccccc3C)C(=O)CN(CCC)S(=O)(=O)CC)CC2)cc1 |
| InChI | InChI=1S/C31H45N3O5S/c1-5-8-22-39-29-15-13-26(14-16-29)31(36)32-20-17-28(18-21-32)34(23-27-12-10-9-11-25(27)4)30(35)24-33(19-6-2)40(37,38)7-3/h9-16,28H,5-8,17-24H2,1-4H3 |
| InChIKey | PIZKBKZVKDCPLI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|