About methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate
methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 4610937) has the molecular formula C14H17N5O3
and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate |
| PubChem CID | 4610937 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CC(=O)Nc2cccc(C)c2C)c1N |
| InChI | InChI=1S/C14H17N5O3/c1-8-5-4-6-10(9(8)2)16-11(20)7-19-13(15)12(17-18-19)14(21)22-3/h4-6H,7,15H2,1-3H3,(H,16,20) |
| InChIKey | HJJLCGYYNPQUSM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate?
The IUPAC name of methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate (CID 4610937) is methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate?
The canonical SMILES for methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate is COC(=O)c1nnn(CC(=O)Nc2cccc(C)c2C)c1N.
What is the InChIKey of methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate?
The InChIKey is HJJLCGYYNPQUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O3/c1-8-5-4-6-10(9(8)2)16-11(20)7-19-13(15)12(17-18-19)14(21)22-3/h4-6H,7,15H2,1-3H3,(H,16,20).
What are the key properties of methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate?
methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate has a molecular weight of 303.32 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-1-[2-(2,3-dimethylanilino)-2-oxoethyl]triazole-4-carboxylate is sourced from PubChem (CID 4610937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).