C16H14N6S2 — CID 4611016
6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 4611016) has the molecular formula C16H14N6S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 4611016 |
| Molecular Formula | C16H14N6S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)nc(SCc2nn3c(-c4ccccc4)nnc3s2)n1 |
| InChI | InChI=1S/C16H14N6S2/c1-10-8-11(2)18-15(17-10)23-9-13-21-22-14(19-20-16(22)24-13)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3 |
| InChIKey | MLNMBHSLSCNMNY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |