C15H8Br2N2OS2 — CID 4611043
5-bromo-N-(6-bromo-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide (PubChem CID 4611043) has the molecular formula C15H8Br2N2OS2 and a molecular weight of 456.18 g/mol. Its IUPAC name is 5-bromo-N-(6-bromo-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(6-bromo-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4611043 |
| Molecular Formula | C15H8Br2N2OS2 |
| Molecular Weight | 456.18 g/mol |
| Exact Mass | 453.84 |
| IUPAC Name | 5-bromo-N-(6-bromo-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Br)s2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H8Br2N2OS2/c1-2-7-19-10-4-3-9(16)8-12(10)22-15(19)18-14(20)11-5-6-13(17)21-11/h1,3-6,8H,7H2/b18-15- |
| InChIKey | CDJLFOVDAWVARK-SDXDJHTJSA-N |
| XLogP | 4.66 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.18 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|