About 3-acetamido-2,4,6-triiodobenzoate
3-acetamido-2,4,6-triiodobenzoate (PubChem CID 4611060) has the molecular formula C9H5I3NO3-
and a molecular weight of 555.86 g/mol. Its IUPAC name is 3-acetamido-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | 3-acetamido-2,4,6-triiodobenzoate |
| PubChem CID | 4611060 |
| Molecular Formula | C9H5I3NO3- |
| Molecular Weight | 555.86 g/mol |
| Exact Mass | 555.74 |
| IUPAC Name | 3-acetamido-2,4,6-triiodobenzoate |
| SMILES | CC(=O)Nc1c(I)cc(I)c(C(=O)[O-])c1I |
| InChI | InChI=1S/C9H6I3NO3/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16/h2H,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | GNOGSFBXBWBTIG-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.86 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamido-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-2,4,6-triiodobenzoate?
The IUPAC name of 3-acetamido-2,4,6-triiodobenzoate (CID 4611060) is 3-acetamido-2,4,6-triiodobenzoate.
What is the SMILES notation for 3-acetamido-2,4,6-triiodobenzoate?
The canonical SMILES for 3-acetamido-2,4,6-triiodobenzoate is CC(=O)Nc1c(I)cc(I)c(C(=O)[O-])c1I.
What is the InChIKey of 3-acetamido-2,4,6-triiodobenzoate?
The InChIKey is GNOGSFBXBWBTIG-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6I3NO3/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16/h2H,1H3,(H,13,14)(H,15,16)/p-1.
What are the key properties of 3-acetamido-2,4,6-triiodobenzoate?
3-acetamido-2,4,6-triiodobenzoate has a molecular weight of 555.86 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-2,4,6-triiodobenzoate is sourced from PubChem (CID 4611060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).