C23H24F2N2O2 — CID 4611125
6-[4-(difluoromethoxy)phenyl]-3,9,9-trimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 4611125) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is 6-[4-(difluoromethoxy)phenyl]-3,9,9-trimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-[4-(difluoromethoxy)phenyl]-3,9,9-trimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 4611125 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 6-[4-(difluoromethoxy)phenyl]-3,9,9-trimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc2c(c1)NC(c1ccc(OC(F)F)cc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C23H24F2N2O2/c1-13-4-9-16-17(10-13)27-21(14-5-7-15(8-6-14)29-22(24)25)20-18(26-16)11-23(2,3)12-19(20)28/h4-10,21-22,26-27H,11-12H2,1-3H3 |
| InChIKey | GDWMSAPPOLBWQL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |