C26H31N3O5 — CID 46111906
5-(3-methoxyphenyl)-N-(2-methylpropyl)-N-[3-oxo-3-(2-phenoxyethylamino)propyl]-1,2-oxazole-3-carboxamide (PubChem CID 46111906) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-N-(2-methylpropyl)-N-[3-oxo-3-(2-phenoxyethylamino)propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3-methoxyphenyl)-N-(2-methylpropyl)-N-[3-oxo-3-(2-phenoxyethylamino)propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46111906 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 5-(3-methoxyphenyl)-N-(2-methylpropyl)-N-[3-oxo-3-(2-phenoxyethylamino)propyl]-1,2-oxazole-3-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)N(CCC(=O)NCCOc3ccccc3)CC(C)C)no2)c1 |
| InChI | InChI=1S/C26H31N3O5/c1-19(2)18-29(14-12-25(30)27-13-15-33-21-9-5-4-6-10-21)26(31)23-17-24(34-28-23)20-8-7-11-22(16-20)32-3/h4-11,16-17,19H,12-15,18H2,1-3H3,(H,27,30) |
| InChIKey | YLYKTHVIQPEXBU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|