C15H16FN3O2S — CID 46114215
N,N-diethyl-2-[(2-fluorobenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 46114215) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is N,N-diethyl-2-[(2-fluorobenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N,N-diethyl-2-[(2-fluorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46114215 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N,N-diethyl-2-[(2-fluorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1csc(NC(=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C15H16FN3O2S/c1-3-19(4-2)14(21)12-9-22-15(17-12)18-13(20)10-7-5-6-8-11(10)16/h5-9H,3-4H2,1-2H3,(H,17,18,20) |
| InChIKey | AYYNVXMSPPDBAD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |