About 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate
2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate (PubChem CID 4611599) has the molecular formula C22H16ClFN2O4S
and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate |
| PubChem CID | 4611599 |
| Molecular Formula | C22H16ClFN2O4S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate |
| SMILES | O=C(OCCN(C1=NS(=O)(=O)c2ccccc21)c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16ClFN2O4S/c23-16-7-11-18(12-8-16)26(13-14-30-22(27)15-5-9-17(24)10-6-15)21-19-3-1-2-4-20(19)31(28,29)25-21/h1-12H,13-14H2 |
| InChIKey | QQCUNTUDGCZNBD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate?
The IUPAC name of 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate (CID 4611599) is 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate.
What is the SMILES notation for 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate?
The canonical SMILES for 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate is O=C(OCCN(C1=NS(=O)(=O)c2ccccc21)c1ccc(Cl)cc1)c1ccc(F)cc1.
What is the InChIKey of 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate?
The InChIKey is QQCUNTUDGCZNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClFN2O4S/c23-16-7-11-18(12-8-16)26(13-14-30-22(27)15-5-9-17(24)10-6-15)21-19-3-1-2-4-20(19)31(28,29)25-21/h1-12H,13-14H2.
What are the key properties of 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate?
2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate has a molecular weight of 458.90 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 4-fluorobenzoate is sourced from PubChem (CID 4611599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).