C31H35N5O3S — CID 4611629
[2-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone (PubChem CID 4611629) has the molecular formula C31H35N5O3S and a molecular weight of 557.72 g/mol. Its IUPAC name is [2-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone.
| Compound Name | [2-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone |
|---|---|
| PubChem CID | 4611629 |
| Molecular Formula | C31H35N5O3S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | [2-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-oxazol-4-yl]-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone |
| SMILES | COc1ccc(-n2c(Cc3ccccc3)nnc2SCc2nc(C(=O)N3CC4(C)CC3CC(C)(C)C4)co2)cc1 |
| InChI | InChI=1S/C31H35N5O3S/c1-30(2)15-23-16-31(3,19-30)20-35(23)28(37)25-17-39-27(32-25)18-40-29-34-33-26(14-21-8-6-5-7-9-21)36(29)22-10-12-24(38-4)13-11-22/h5-13,17,23H,14-16,18-20H2,1-4H3 |
| InChIKey | WEGKHQZZCJOLDP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |