C18H23ClN4OS — CID 4611709
N-butyl-1-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pyrrolidine-2-carboxamide (PubChem CID 4611709) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is N-butyl-1-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-butyl-1-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4611709 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-butyl-1-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN1c1nc(Cc2ccc(Cl)cc2)ns1 |
| InChI | InChI=1S/C18H23ClN4OS/c1-2-3-10-20-17(24)15-5-4-11-23(15)18-21-16(22-25-18)12-13-6-8-14(19)9-7-13/h6-9,15H,2-5,10-12H2,1H3,(H,20,24) |
| InChIKey | UUOBZHDBHOGXKT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|