C27H32N2O5S — CID 4611910
N-(2-methoxyphenyl)-6-methyl-2-[(2,3,4-trimethoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4611910) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-6-methyl-2-[(2,3,4-trimethoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-6-methyl-2-[(2,3,4-trimethoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4611910 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-(2-methoxyphenyl)-6-methyl-2-[(2,3,4-trimethoxyphenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1c(NCc2ccc(OC)c(OC)c2OC)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C27H32N2O5S/c1-16-10-12-18-22(14-16)35-27(23(18)26(30)29-19-8-6-7-9-20(19)31-2)28-15-17-11-13-21(32-3)25(34-5)24(17)33-4/h6-9,11,13,16,28H,10,12,14-15H2,1-5H3,(H,29,30) |
| InChIKey | SXNXVGVCQXPXNA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_H(2)', 'substructure': 'N/A'} |
|---|