C19H15FNO3- — CID 4612306
3-[5-(4-fluorophenyl)-1-(3-hydroxyphenyl)pyrrol-2-yl]propanoate (PubChem CID 4612306) has the molecular formula C19H15FNO3- and a molecular weight of 324.33 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-(3-hydroxyphenyl)pyrrol-2-yl]propanoate.
| Compound Name | 3-[5-(4-fluorophenyl)-1-(3-hydroxyphenyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 4612306 |
| Molecular Formula | C19H15FNO3- |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-(3-hydroxyphenyl)pyrrol-2-yl]propanoate |
| SMILES | O=C([O-])CCc1ccc(-c2ccc(F)cc2)n1-c1cccc(O)c1 |
| InChI | InChI=1S/C19H16FNO3/c20-14-6-4-13(5-7-14)18-10-8-15(9-11-19(23)24)21(18)16-2-1-3-17(22)12-16/h1-8,10,12,22H,9,11H2,(H,23,24)/p-1 |
| InChIKey | WSPPGUWZZQSSHS-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|