About 1-benzyl-3-(2,4-dimethylphenyl)urea
1-benzyl-3-(2,4-dimethylphenyl)urea (PubChem CID 4612352) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-3-(2,4-dimethylphenyl)urea |
| PubChem CID | 4612352 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-benzyl-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H18N2O/c1-12-8-9-15(13(2)10-12)18-16(19)17-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | NIVTZXFKQORAFR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-3-(2,4-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(2,4-dimethylphenyl)urea?
The IUPAC name of 1-benzyl-3-(2,4-dimethylphenyl)urea (CID 4612352) is 1-benzyl-3-(2,4-dimethylphenyl)urea.
What is the SMILES notation for 1-benzyl-3-(2,4-dimethylphenyl)urea?
The canonical SMILES for 1-benzyl-3-(2,4-dimethylphenyl)urea is Cc1ccc(NC(=O)NCc2ccccc2)c(C)c1.
What is the InChIKey of 1-benzyl-3-(2,4-dimethylphenyl)urea?
The InChIKey is NIVTZXFKQORAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-12-8-9-15(13(2)10-12)18-16(19)17-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H2,17,18,19).
What are the key properties of 1-benzyl-3-(2,4-dimethylphenyl)urea?
1-benzyl-3-(2,4-dimethylphenyl)urea has a molecular weight of 254.33 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(2,4-dimethylphenyl)urea is sourced from PubChem (CID 4612352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).