C32H32N4O4 — CID 46126533
3-[1-[1-(3,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 46126533) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is 3-[1-[1-(3,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[1-(3,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 46126533 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 3-[1-[1-(3,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)c2C)cc1OC |
| InChI | InChI=1S/C32H32N4O4/c1-21-25(31(37)34-17-15-23(16-18-34)36-27-12-8-7-11-26(27)33-32(36)38)20-28(22-9-5-4-6-10-22)35(21)24-13-14-29(39-2)30(19-24)40-3/h4-14,19-20,23H,15-18H2,1-3H3,(H,33,38) |
| InChIKey | GDIDHLBCYUZDTA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|