C30H29ClFN3O2 — CID 46126575
[5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 46126575) has the molecular formula C30H29ClFN3O2 and a molecular weight of 518.03 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46126575 |
| Molecular Formula | C30H29ClFN3O2 |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrol-3-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(F)cc3)c2C)CC1 |
| InChI | InChI=1S/C30H29ClFN3O2/c1-3-37-29-7-5-4-6-27(29)33-16-18-34(19-17-33)30(36)26-20-28(22-8-10-23(31)11-9-22)35(21(26)2)25-14-12-24(32)13-15-25/h4-15,20H,3,16-19H2,1-2H3 |
| InChIKey | LFYRZUWGMYCBAD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|