C32H41N5O — CID 46127049
[4-(4-ethylpiperazin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-hexylphenyl)methanone (PubChem CID 46127049) has the molecular formula C32H41N5O and a molecular weight of 511.71 g/mol. Its IUPAC name is [4-(4-ethylpiperazin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-hexylphenyl)methanone.
| Compound Name | [4-(4-ethylpiperazin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 46127049 |
| Molecular Formula | C32H41N5O |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | [4-(4-ethylpiperazin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCc3nc(-c4ccccc4)nc(N4CCN(CC)CC4)c3C2)cc1 |
| InChI | InChI=1S/C32H41N5O/c1-3-5-6-8-11-25-14-16-27(17-15-25)32(38)37-19-18-29-28(24-37)31(36-22-20-35(4-2)21-23-36)34-30(33-29)26-12-9-7-10-13-26/h7,9-10,12-17H,3-6,8,11,18-24H2,1-2H3 |
| InChIKey | ZQCZKBZRXYAPLD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|