C23H28N2O4 — CID 46130139
methyl 4-[2-[ethyl-[(E)-3-phenylprop-2-enoyl]amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 46130139) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 4-[2-[ethyl-[(E)-3-phenylprop-2-enoyl]amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[ethyl-[(E)-3-phenylprop-2-enoyl]amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46130139 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 4-[2-[ethyl-[(E)-3-phenylprop-2-enoyl]amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCN(C(=O)/C=C/c1ccccc1)C(C)C(=O)c1c(C)c(C(=O)OC)n(C)c1C |
| InChI | InChI=1S/C23H28N2O4/c1-7-25(19(26)14-13-18-11-9-8-10-12-18)17(4)22(27)20-15(2)21(23(28)29-6)24(5)16(20)3/h8-14,17H,7H2,1-6H3/b14-13+ |
| InChIKey | NDVZWIDZADQWSF-BUHFOSPRSA-N |
| XLogP | 3.56 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|