C31H37FN2O4 — CID 46130179
methyl 4-[2-[(4-fluorophenyl)methyl-(4-pentylbenzoyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 46130179) has the molecular formula C31H37FN2O4 and a molecular weight of 520.65 g/mol. Its IUPAC name is methyl 4-[2-[(4-fluorophenyl)methyl-(4-pentylbenzoyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-fluorophenyl)methyl-(4-pentylbenzoyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46130179 |
| Molecular Formula | C31H37FN2O4 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | methyl 4-[2-[(4-fluorophenyl)methyl-(4-pentylbenzoyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(F)cc2)C(C)C(=O)c2c(C)c(C(=O)OC)n(C)c2C)cc1 |
| InChI | InChI=1S/C31H37FN2O4/c1-7-8-9-10-23-11-15-25(16-12-23)30(36)34(19-24-13-17-26(32)18-14-24)22(4)29(35)27-20(2)28(31(37)38-6)33(5)21(27)3/h11-18,22H,7-10,19H2,1-6H3 |
| InChIKey | FSUBNZRATRYFKR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|