C23H36N2O4 — CID 46130264
ethyl 4-[2-[cyclopropyl(octanoyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 46130264) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl 4-[2-[cyclopropyl(octanoyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[cyclopropyl(octanoyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46130264 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | ethyl 4-[2-[cyclopropyl(octanoyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCCCCCCC(=O)N(CC(=O)c1c(C)c(C(=O)OCC)n(C)c1C)C1CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-6-8-9-10-11-12-20(27)25(18-13-14-18)15-19(26)21-16(3)22(23(28)29-7-2)24(5)17(21)4/h18H,6-15H2,1-5H3 |
| InChIKey | QLWPMARIKLHITM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|