C6H6F7NO2 — CID 4613030
2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide (PubChem CID 4613030) has the molecular formula C6H6F7NO2 and a molecular weight of 257.11 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 4613030 |
| Molecular Formula | C6H6F7NO2 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide |
| SMILES | O=C(NCCO)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7NO2/c7-4(8,3(16)14-1-2-15)5(9,10)6(11,12)13/h15H,1-2H2,(H,14,16) |
| InChIKey | KPTAUHCSUNOZRL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|