C22H29ClN4O2 — CID 4613049
N-[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]-4-oxo-4-piperidin-1-ylbutanamide (PubChem CID 4613049) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]-4-oxo-4-piperidin-1-ylbutanamide.
| Compound Name | N-[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]-4-oxo-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 4613049 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]-4-oxo-4-piperidin-1-ylbutanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CCC(=O)N2CCCCC2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-22(2,3)18-15-19(27(25-18)17-9-7-16(23)8-10-17)24-20(28)11-12-21(29)26-13-5-4-6-14-26/h7-10,15H,4-6,11-14H2,1-3H3,(H,24,28) |
| InChIKey | WLJPAZKTADVDJK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |