C24H28N2O4 — CID 4613311
4-hydroxy-4,5,5-trimethyl-3-[2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 4613311) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-hydroxy-4,5,5-trimethyl-3-[2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-hydroxy-4,5,5-trimethyl-3-[2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 4613311 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-hydroxy-4,5,5-trimethyl-3-[2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1[nH]c2ccc(OCc3ccccc3)cc2c1CCN1C(=O)OC(C)(C)C1(C)O |
| InChI | InChI=1S/C24H28N2O4/c1-16-19(12-13-26-22(27)30-23(2,3)24(26,4)28)20-14-18(10-11-21(20)25-16)29-15-17-8-6-5-7-9-17/h5-11,14,25,28H,12-13,15H2,1-4H3 |
| InChIKey | WWKQOXCTOXDLIB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|