About 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine
2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 46133539) has the molecular formula C28H26FN7
and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 46133539 |
| Molecular Formula | C28H26FN7 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Nc1c2c(-c3ccccc3F)nc(N3CCN(c4ccccc4)CC3)nc2nn1Cc1ccccc1 |
| InChI | InChI=1S/C28H26FN7/c29-23-14-8-7-13-22(23)25-24-26(30)36(19-20-9-3-1-4-10-20)33-27(24)32-28(31-25)35-17-15-34(16-18-35)21-11-5-2-6-12-21/h1-14H,15-19,30H2 |
| InChIKey | OYWJBIVOIQKLPZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine (CID 46133539) is 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine is Nc1c2c(-c3ccccc3F)nc(N3CCN(c4ccccc4)CC3)nc2nn1Cc1ccccc1.
What is the InChIKey of 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is OYWJBIVOIQKLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26FN7/c29-23-14-8-7-13-22(23)25-24-26(30)36(19-20-9-3-1-4-10-20)33-27(24)32-28(31-25)35-17-15-34(16-18-35)21-11-5-2-6-12-21/h1-14H,15-19,30H2.
What are the key properties of 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine?
2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 479.56 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 46133539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).