C24H15F5Pb — CID 4613552
(2,3,4,5,6-pentafluorophenyl)-triphenylplumbane (PubChem CID 4613552) has the molecular formula C24H15F5Pb and a molecular weight of 605.57 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-triphenylplumbane.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-triphenylplumbane |
|---|---|
| PubChem CID | 4613552 |
| Molecular Formula | C24H15F5Pb |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-triphenylplumbane |
| SMILES | Fc1c(F)c(F)c([Pb](c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C6F5.3C6H5.Pb/c7-2-1-3(8)5(10)6(11)4(2)9;3*1-2-4-6-5-3-1;/h;3*1-5H; |
| InChIKey | SXSRSTVJJBQSEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|