C19H22Cl2N4O3S — CID 46137337
N-cyclopropyl-2-(2,3-dichloroanilino)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazole-4-carboxamide (PubChem CID 46137337) has the molecular formula C19H22Cl2N4O3S and a molecular weight of 457.38 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,3-dichloroanilino)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclopropyl-2-(2,3-dichloroanilino)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46137337 |
| Molecular Formula | C19H22Cl2N4O3S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-cyclopropyl-2-(2,3-dichloroanilino)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)CCN(C(=O)c1csc(Nc2cccc(Cl)c2Cl)n1)C1CC1 |
| InChI | InChI=1S/C19H22Cl2N4O3S/c1-28-10-8-22-16(26)7-9-25(12-5-6-12)18(27)15-11-29-19(24-15)23-14-4-2-3-13(20)17(14)21/h2-4,11-12H,5-10H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | FBXPABQWXAPQJM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|