C16H16N4O2S2 — CID 4613857
3-amino-N-(2,4-dimethylphenyl)-5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 4613857) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethylphenyl)-5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-amino-N-(2,4-dimethylphenyl)-5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4613857 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-amino-N-(2,4-dimethylphenyl)-5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3[nH]c(=S)n(N)c(=O)c3c2C)c(C)c1 |
| InChI | InChI=1S/C16H16N4O2S2/c1-7-4-5-10(8(2)6-7)18-13(21)12-9(3)11-14(24-12)19-16(23)20(17)15(11)22/h4-6H,17H2,1-3H3,(H,18,21)(H,19,23) |
| InChIKey | VVVGKJXGJUJFHP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|