About N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide
N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide (PubChem CID 4614056) has the molecular formula C27H17N5O4
and a molecular weight of 475.46 g/mol. Its IUPAC name is N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide.
Molecular Properties
| Compound Name | N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide |
| PubChem CID | 4614056 |
| Molecular Formula | C27H17N5O4 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccc(-c4nc5ccccc5o4)cc3[nH]2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H17N5O4/c33-26(17-7-12-20(13-8-17)32(34)35)28-19-10-5-16(6-11-19)25-29-21-14-9-18(15-23(21)30-25)27-31-22-3-1-2-4-24(22)36-27/h1-15H,(H,28,33)(H,29,30) |
| InChIKey | GLXBFPCFOJUPEQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide?
The IUPAC name of N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide (CID 4614056) is N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide.
What is the SMILES notation for N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide?
The canonical SMILES for N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide is O=C(Nc1ccc(-c2nc3ccc(-c4nc5ccccc5o4)cc3[nH]2)cc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide?
The InChIKey is GLXBFPCFOJUPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17N5O4/c33-26(17-7-12-20(13-8-17)32(34)35)28-19-10-5-16(6-11-19)25-29-21-14-9-18(15-23(21)30-25)27-31-22-3-1-2-4-24(22)36-27/h1-15H,(H,28,33)(H,29,30).
What are the key properties of N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide?
N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide has a molecular weight of 475.46 g/mol, XLogP of 6.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[6-(1,3-benzoxazol-2-yl)-1H-benzimidazol-2-yl]phenyl]-4-nitrobenzamide is sourced from PubChem (CID 4614056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).