C15H11N5 — CID 4614196
3-[3-(dimethylamino)phenyl]cyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 4614196) has the molecular formula C15H11N5 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-[3-(dimethylamino)phenyl]cyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-[3-(dimethylamino)phenyl]cyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 4614196 |
| Molecular Formula | C15H11N5 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[3-(dimethylamino)phenyl]cyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | CN(C)c1cccc(C2C(C#N)(C#N)C2(C#N)C#N)c1 |
| InChI | InChI=1S/C15H11N5/c1-20(2)12-5-3-4-11(6-12)13-14(7-16,8-17)15(13,9-18)10-19/h3-6,13H,1-2H3 |
| InChIKey | DVMHHJXWSRGAFL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|