About 2-butyl-6-phenylpyridine
2-butyl-6-phenylpyridine (PubChem CID 4614438) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-butyl-6-phenylpyridine.
Molecular Properties
| Compound Name | 2-butyl-6-phenylpyridine |
| PubChem CID | 4614438 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-butyl-6-phenylpyridine |
| SMILES | CCCCc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N/c1-2-3-10-14-11-7-12-15(16-14)13-8-5-4-6-9-13/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | DSCUZYVYDVDBTP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-6-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-phenylpyridine?
The IUPAC name of 2-butyl-6-phenylpyridine (CID 4614438) is 2-butyl-6-phenylpyridine.
What is the SMILES notation for 2-butyl-6-phenylpyridine?
The canonical SMILES for 2-butyl-6-phenylpyridine is CCCCc1cccc(-c2ccccc2)n1.
What is the InChIKey of 2-butyl-6-phenylpyridine?
The InChIKey is DSCUZYVYDVDBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-2-3-10-14-11-7-12-15(16-14)13-8-5-4-6-9-13/h4-9,11-12H,2-3,10H2,1H3.
What are the key properties of 2-butyl-6-phenylpyridine?
2-butyl-6-phenylpyridine has a molecular weight of 211.31 g/mol, XLogP of 4.09, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-phenylpyridine is sourced from PubChem (CID 4614438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).