C32H41N5O3S — CID 46147955
4-[[4-tert-butyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 46147955) has the molecular formula C32H41N5O3S and a molecular weight of 575.78 g/mol. Its IUPAC name is 4-[[4-tert-butyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[4-tert-butyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46147955 |
| Molecular Formula | C32H41N5O3S |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 4-[[4-tert-butyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccc(N2CCN(c3cc(C(C)(C)C)nc(SCc4ccc(C(=O)NCC5CCCO5)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C32H41N5O3S/c1-32(2,3)28-20-29(37-17-15-36(16-18-37)25-11-13-26(39-4)14-12-25)35-31(34-28)41-22-23-7-9-24(10-8-23)30(38)33-21-27-6-5-19-40-27/h7-14,20,27H,5-6,15-19,21-22H2,1-4H3,(H,33,38) |
| InChIKey | PXHIAYHNTSXUTR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|