C21H28N4OS — CID 46157835
[2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-1,3-thiazol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 46157835) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is [2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-1,3-thiazol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-1,3-thiazol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 46157835 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-1,3-thiazol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(N2CCN(Cc3nc(C(=O)N4CCCC4)cs3)CC2)cc1C |
| InChI | InChI=1S/C21H28N4OS/c1-16-5-6-18(13-17(16)2)24-11-9-23(10-12-24)14-20-22-19(15-27-20)21(26)25-7-3-4-8-25/h5-6,13,15H,3-4,7-12,14H2,1-2H3 |
| InChIKey | RVYXRBNNHLRUJQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|