C22H28N2O3 — CID 46161787
N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxy-N-(4-methylphenyl)acetamide (PubChem CID 46161787) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxy-N-(4-methylphenyl)acetamide.
| Compound Name | N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxy-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 46161787 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxy-N-(4-methylphenyl)acetamide |
| SMILES | COCC(=O)N(c1ccc(C)cc1)C1CCN(Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-17-7-9-19(10-8-17)24(22(26)16-27-2)20-11-13-23(14-12-20)15-18-5-3-4-6-21(18)25/h3-10,20,25H,11-16H2,1-2H3 |
| InChIKey | WARTUGWKBWPVKB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|