About 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine
4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine (PubChem CID 46167952) has the molecular formula C13H10FNS
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine |
| PubChem CID | 46167952 |
| Molecular Formula | C13H10FNS |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine |
| SMILES | Fc1cccc(C2=NCCc3sccc32)c1 |
| InChI | InChI=1S/C13H10FNS/c14-10-3-1-2-9(8-10)13-11-5-7-16-12(11)4-6-15-13/h1-3,5,7-8H,4,6H2 |
| InChIKey | MWZYLZYVYYUBRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine?
The IUPAC name of 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine (CID 46167952) is 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine.
What is the SMILES notation for 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine?
The canonical SMILES for 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine is Fc1cccc(C2=NCCc3sccc32)c1.
What is the InChIKey of 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine?
The InChIKey is MWZYLZYVYYUBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNS/c14-10-3-1-2-9(8-10)13-11-5-7-16-12(11)4-6-15-13/h1-3,5,7-8H,4,6H2.
What are the key properties of 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine?
4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine has a molecular weight of 231.30 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-6,7-dihydrothieno[3,2-c]pyridine is sourced from PubChem (CID 46167952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).