About hex-4-en-1-yn-3-yl acetate
hex-4-en-1-yn-3-yl acetate (PubChem CID 4616846) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is hex-4-en-1-yn-3-yl acetate.
Molecular Properties
| Compound Name | hex-4-en-1-yn-3-yl acetate |
| PubChem CID | 4616846 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | hex-4-en-1-yn-3-yl acetate |
| SMILES | C#CC(C=CC)OC(C)=O |
| InChI | InChI=1S/C8H10O2/c1-4-6-8(5-2)10-7(3)9/h2,4,6,8H,1,3H3 |
| InChIKey | WMJTVRRLWZPLEJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-4-en-1-yn-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-4-en-1-yn-3-yl acetate?
The IUPAC name of hex-4-en-1-yn-3-yl acetate (CID 4616846) is hex-4-en-1-yn-3-yl acetate.
What is the SMILES notation for hex-4-en-1-yn-3-yl acetate?
The canonical SMILES for hex-4-en-1-yn-3-yl acetate is C#CC(C=CC)OC(C)=O.
What is the InChIKey of hex-4-en-1-yn-3-yl acetate?
The InChIKey is WMJTVRRLWZPLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-4-6-8(5-2)10-7(3)9/h2,4,6,8H,1,3H3.
What are the key properties of hex-4-en-1-yn-3-yl acetate?
hex-4-en-1-yn-3-yl acetate has a molecular weight of 138.17 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-4-en-1-yn-3-yl acetate is sourced from PubChem (CID 4616846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).