C14H14N2O2S — CID 4616894
2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine (PubChem CID 4616894) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine.
| Compound Name | 2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine |
|---|---|
| PubChem CID | 4616894 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine |
| SMILES | Cc1cc2c(cc1N)S(=O)(=O)c1cc(N)c(C)cc1-2 |
| InChI | InChI=1S/C14H14N2O2S/c1-7-3-9-10-4-8(2)12(16)6-14(10)19(17,18)13(9)5-11(7)15/h3-6H,15-16H2,1-2H3 |
| InChIKey | OJSPYCPPVCMEBS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|