C33H27N3O5 — CID 4616967
5-benzoyl-6-(4-methoxyphenyl)-9-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 4616967) has the molecular formula C33H27N3O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is 5-benzoyl-6-(4-methoxyphenyl)-9-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-benzoyl-6-(4-methoxyphenyl)-9-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 4616967 |
| Molecular Formula | C33H27N3O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 5-benzoyl-6-(4-methoxyphenyl)-9-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc(C2C3=C(CC(c4cccc([N+](=O)[O-])c4)CC3=O)Nc3ccccc3N2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H27N3O5/c1-41-26-16-14-21(15-17-26)32-31-28(19-24(20-30(31)37)23-10-7-11-25(18-23)36(39)40)34-27-12-5-6-13-29(27)35(32)33(38)22-8-3-2-4-9-22/h2-18,24,32,34H,19-20H2,1H3 |
| InChIKey | WNQZKLOIWQPZNA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|