C23H26N4OS2 — CID 4617150
1-(1,3-benzothiazol-2-yl)-3,7,7-trimethyl-4-(2-methylsulfanylethyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 4617150) has the molecular formula C23H26N4OS2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3,7,7-trimethyl-4-(2-methylsulfanylethyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3,7,7-trimethyl-4-(2-methylsulfanylethyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 4617150 |
| Molecular Formula | C23H26N4OS2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3,7,7-trimethyl-4-(2-methylsulfanylethyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | CSCCC1C2=C(CC(C)(C)CC2=O)Nc2c1c(C)nn2-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H26N4OS2/c1-13-19-14(9-10-29-4)20-16(11-23(2,3)12-17(20)28)24-21(19)27(26-13)22-25-15-7-5-6-8-18(15)30-22/h5-8,14,24H,9-12H2,1-4H3 |
| InChIKey | YJOQTSVEXFWMEO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |