About (Z)-3-aminoprop-2-enoate
(Z)-3-aminoprop-2-enoate (PubChem CID 46173135) has the molecular formula C3H4NO2-
and a molecular weight of 86.07 g/mol. Its IUPAC name is (Z)-3-aminoprop-2-enoate.
Molecular Properties
| Compound Name | (Z)-3-aminoprop-2-enoate |
| PubChem CID | 46173135 |
| Molecular Formula | C3H4NO2- |
| Molecular Weight | 86.07 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | (Z)-3-aminoprop-2-enoate |
| SMILES | N/C=C\C(=O)[O-] |
| InChI | InChI=1S/C3H5NO2/c4-2-1-3(5)6/h1-2H,4H2,(H,5,6)/p-1/b2-1- |
| InChIKey | YTLYLLTVENPWFT-UPHRSURJSA-M |
| XLogP | -1.79 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.07 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-aminoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-aminoprop-2-enoate?
The IUPAC name of (Z)-3-aminoprop-2-enoate (CID 46173135) is (Z)-3-aminoprop-2-enoate.
What is the SMILES notation for (Z)-3-aminoprop-2-enoate?
The canonical SMILES for (Z)-3-aminoprop-2-enoate is N/C=C\C(=O)[O-].
What is the InChIKey of (Z)-3-aminoprop-2-enoate?
The InChIKey is YTLYLLTVENPWFT-UPHRSURJSA-M. The full InChI is InChI=1S/C3H5NO2/c4-2-1-3(5)6/h1-2H,4H2,(H,5,6)/p-1/b2-1-.
What are the key properties of (Z)-3-aminoprop-2-enoate?
(Z)-3-aminoprop-2-enoate has a molecular weight of 86.07 g/mol, XLogP of -1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-aminoprop-2-enoate is sourced from PubChem (CID 46173135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).