About p-Benzosemiquinone
p-Benzosemiquinone (PubChem CID 46173720) has the molecular formula C6H5O2
and a molecular weight of 109.10 g/mol.
Molecular Properties
| Compound Name | p-Benzosemiquinone |
| PubChem CID | 46173720 |
| Molecular Formula | C6H5O2 |
| Molecular Weight | 109.10 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | — |
| SMILES | [O]c1ccc(O)cc1 |
| InChI | InChI=1S/C6H5O2/c7-5-1-2-6(8)4-3-5/h1-4,7H |
| InChIKey | XLHUBROMZOAQMV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze p-Benzosemiquinone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of p-Benzosemiquinone?
The IUPAC name of p-Benzosemiquinone (CID 46173720) is not available.
What is the SMILES notation for p-Benzosemiquinone?
The canonical SMILES for p-Benzosemiquinone is [O]c1ccc(O)cc1.
What is the InChIKey of p-Benzosemiquinone?
The InChIKey is XLHUBROMZOAQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O2/c7-5-1-2-6(8)4-3-5/h1-4,7H.
What are the key properties of p-Benzosemiquinone?
p-Benzosemiquinone has a molecular weight of 109.10 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for p-Benzosemiquinone is sourced from PubChem (CID 46173720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).